Products 1261779-40-1
CAS 1261779-40-1 is the registry number for 2-Chloro-6-(trifluoromethoxy)benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-chloro-6-(trifluoromethoxy)benzonitrile (CAS 1261779-40-1) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 2-chloro-6-(trifluoromethoxy)benzonitrile. InChIKey: NTRGETPKMRGTRQ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethoxy)benzonitrile |
| InChIKey | NTRGETPKMRGTRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C#N)OC(F)(F)F |
Computed by PubChem (NCBI)