CAS 51488-22-3 appears in our catalog under these names: 2-Chloro-4-(trifluoromethyl)phenyl isocyanate, 95%, 2-Chloro-4-(trifluoromethyl)phenyl, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
2-chloro-1-isocyanato-4-(trifluoromethyl)benzene (CAS 51488-22-3) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 2-chloro-1-isocyanato-4-(trifluoromethyl)benzene. InChIKey: NEURYOYRKPFLKH-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 2-chloro-1-isocyanato-4-(trifluoromethyl)benzene |
| InChIKey | NEURYOYRKPFLKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)N=C=O |
Computed by PubChem (NCBI)