CAS 327-78-6 appears in our catalog under these names: 4-Chloro-3-(trifluoromethyl)phenyl isocyanate, 97%, Chloro-3-(trifluoromethyl)phenyl isocyanate, 4-Chloro-3-(trifluoromethyl)phenyl Isocyanate, 4–Chloro–3–(trifluoromethyl)phenyl isocyanate, 4-Chloro-3-(trifluoromethyl)phenyl isocyanate, 97% . Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 100g, 25g, 5g, 500g, on request, 10g, 500mg, 1g.
1-chloro-4-isocyanato-2-(trifluoromethyl)benzene (CAS 327-78-6) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene. InChIKey: NBJZEUQTGLSUOB-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | NBJZEUQTGLSUOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)