cas: 83279-38-3 — see every product listed under this CAS number, including other names
3-Chloro-4-(trifluoromethyl)benzaldehyde, 95%, 95% (CAS 83279-38-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115XGW-1g |
| cas | 83279-38-3 |
| size | 1g |
| availability | 64g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 366.80 Pln | |
| Chemat | 25g | 808.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-(trifluoromethyl)benzaldehyde (CAS 83279-38-3) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 3-chloro-4-(trifluoromethyl)benzaldehyde. InChIKey: UTSBZTCYCRVHCK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethyl)benzaldehyde |
| InChIKey | UTSBZTCYCRVHCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)