CAS 1241914-79-3 is the registry number for 2,2-Difluoro-2-(4-fluorophenyl)acetyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-(4-fluorophenyl)acetyl chloride (CAS 1241914-79-3) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 2,2-difluoro-2-(4-fluorophenyl)acetyl chloride. InChIKey: YULZBZRGKUXEAN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-fluorophenyl)acetyl chloride |
| InChIKey | YULZBZRGKUXEAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)Cl)(F)F)F |
Computed by PubChem (NCBI)