CAS 1321028-35-6 is the registry number for 2-Chloro-2,2-difluoro-1-(4-fluoro-phenyl)-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-2,2-difluoro-1-(4-fluorophenyl)ethanone (CAS 1321028-35-6) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-(4-fluorophenyl)ethanone. InChIKey: KRQCKYOFJNCNCE-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-(4-fluorophenyl)ethanone |
| InChIKey | KRQCKYOFJNCNCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)(F)Cl)F |
Computed by PubChem (NCBI)