CAS 5860-95-7 appears in our catalog under these names: 2'-Chloro-2,2,2-trifluoroacetophenone, 95%, 1-(2-Chlorophenyl)-2,2,2-trifluoroethanone, 95%, 1-(2-Chlorophenyl)-2,2,2-trifluoroethanone, 96%, 96%, 2'-Chloro-2,2,2-trifluoroacetophenone, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
1-(2-chlorophenyl)-2,2,2-trifluoroethanone (CAS 5860-95-7) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: RAOQEOLDFDHACL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | RAOQEOLDFDHACL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)