CAS 849623-76-3 is the registry number for 3,4,5-Trifluorophenylacetyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(3,4,5-trifluorophenyl)acetyl chloride (CAS 849623-76-3) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 2-(3,4,5-trifluorophenyl)acetyl chloride. InChIKey: LOSDDEPYAXHXSA-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 2-(3,4,5-trifluorophenyl)acetyl chloride |
| InChIKey | LOSDDEPYAXHXSA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)CC(=O)Cl |
Computed by PubChem (NCBI)