cas: 213130-43-9 — see every product listed under this CAS number, including other names
3-Chloro-4-cyanobenzene-1-sulfonyl chloride, 95%, 95% (CAS 213130-43-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C557-100mg |
| cas | 213130-43-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1139.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-cyanobenzenesulfonyl chloride (CAS 213130-43-9) is a chemical compound with the molecular formula C7H3Cl2NO2S and a molecular weight of 236.07 g/mol. IUPAC name: 3-chloro-4-cyanobenzenesulfonyl chloride. InChIKey: HWCNCOCJCVWMBX-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2S |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 3-chloro-4-cyanobenzenesulfonyl chloride |
| InChIKey | HWCNCOCJCVWMBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)Cl)C#N |
Computed by PubChem (NCBI)