CAS 942199-56-6 appears in our catalog under these names: 2-Chloro-5-cyanobenzene-1-sulfonyl chloride 96%, 2-Chloro-5-cyanobenzene-1-sulfonyl chloride, 96%, 96%, 2-Chloro-5-cyanobenzene-1-sulfonyl chloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-chloro-5-cyanobenzenesulfonyl chloride (CAS 942199-56-6) is a chemical compound with the molecular formula C7H3Cl2NO2S and a molecular weight of 236.07 g/mol. IUPAC name: 2-chloro-5-cyanobenzenesulfonyl chloride. InChIKey: IUVMCIXSPYERDI-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2S |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-chloro-5-cyanobenzenesulfonyl chloride |
| InChIKey | IUVMCIXSPYERDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)