Products 942199-56-6

CAS 942199-56-6 appears in our catalog under these names: 2-Chloro-5-cyanobenzene-1-sulfonyl chloride 96%, 2-Chloro-5-cyanobenzene-1-sulfonyl chloride, 96%, 96%, 2-Chloro-5-cyanobenzene-1-sulfonyl chloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-chloro-5-cyanobenzenesulfonyl chloride (CAS 942199-56-6) is a chemical compound with the molecular formula C7H3Cl2NO2S and a molecular weight of 236.07 g/mol. IUPAC name: 2-chloro-5-cyanobenzenesulfonyl chloride. InChIKey: IUVMCIXSPYERDI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2NO2S
Molecular weight236.07 g/mol
IUPAC name2-chloro-5-cyanobenzenesulfonyl chloride
InChIKeyIUVMCIXSPYERDI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C#N)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)