CAS 15864-53-6 is the registry number for 3,6-Dichlorobenzo(d)isothiazole 1,1-dioxide, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,6-dichloro-1,2-benzothiazole 1,1-dioxide (CAS 15864-53-6) is a chemical compound with the molecular formula C7H3Cl2NO2S and a molecular weight of 236.07 g/mol. IUPAC name: 3,6-dichloro-1,2-benzothiazole 1,1-dioxide. InChIKey: VJJUJEMEUPXOOB-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2S |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 3,6-dichloro-1,2-benzothiazole 1,1-dioxide |
| InChIKey | VJJUJEMEUPXOOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)S(=O)(=O)N=C2Cl |
Computed by PubChem (NCBI)