Products 1261499-21-1
CAS 1261499-21-1 is the registry number for 2-Chloro-6-cyanobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-6-cyanobenzenesulfonyl chloride (CAS 1261499-21-1) is a chemical compound with the molecular formula C7H3Cl2NO2S and a molecular weight of 236.07 g/mol. IUPAC name: 2-chloro-6-cyanobenzenesulfonyl chloride. InChIKey: HKLHWYFHASHTMM-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO2S |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-chloro-6-cyanobenzenesulfonyl chloride |
| InChIKey | HKLHWYFHASHTMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)