Products 411210-92-9

CAS 411210-92-9 is the registry number for 5-Chloro-2-cyanobenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-2-cyanobenzenesulfonyl chloride (CAS 411210-92-9) is a chemical compound with the molecular formula C7H3Cl2NO2S and a molecular weight of 236.07 g/mol. IUPAC name: 5-chloro-2-cyanobenzenesulfonyl chloride. InChIKey: PHNDFODTTWOSSX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2NO2S
Molecular weight236.07 g/mol
IUPAC name5-chloro-2-cyanobenzenesulfonyl chloride
InChIKeyPHNDFODTTWOSSX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)C#N

Computed by PubChem (NCBI)