cas: 101774-33-8 — see every product listed under this CAS number, including other names
3-Chloro-4-isoquinolinol, 98%, 98% (CAS 101774-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1116GH-100mg |
| cas | 101774-33-8 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-chloroisoquinolin-4-ol (CAS 101774-33-8) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloroisoquinolin-4-ol. InChIKey: HLMAYSDUIAOBQE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloroisoquinolin-4-ol |
| InChIKey | HLMAYSDUIAOBQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC(=C2O)Cl |
Computed by PubChem (NCBI)