cas: 22233-54-1 — see every product listed under this CAS number, including other names
3-Chloro-5-nitrobenzaldehyde, 95% (CAS 22233-54-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A150929-25g |
| cas | 22233-54-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 5063.17 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1997.23 Pln | |
| Fluorochem | 10g | 3934.05 Pln | |
| Fluorochem | 25g | 9744.50 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-chloro-5-nitrobenzaldehyde (CAS 22233-54-1) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 3-chloro-5-nitrobenzaldehyde. InChIKey: KXGORBDLPVCCOJ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 3-chloro-5-nitrobenzaldehyde |
| InChIKey | KXGORBDLPVCCOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Cl)C=O |
Computed by PubChem (NCBI)