cas: 351003-23-1 — see every product listed under this CAS number, including other names
3-Cyano-4-fluorobenzenesulfonyl chloride 97% (CAS 351003-23-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A842649-250mg |
| cas | 351003-23-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A842649 |
3-cyano-4-fluorobenzenesulfonyl chloride (CAS 351003-23-1) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 3-cyano-4-fluorobenzenesulfonyl chloride. InChIKey: KDVZADPGGPBAAK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-cyano-4-fluorobenzenesulfonyl chloride |
| InChIKey | KDVZADPGGPBAAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C#N)F |
Computed by PubChem (NCBI)