Products 612541-15-8

CAS 612541-15-8 appears in our catalog under these names: 2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 95%, 2-Cyano-5-fluorobenzenesulfonyl chloride, 98%, 2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

2-cyano-5-fluorobenzenesulfonyl chloride (CAS 612541-15-8) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 2-cyano-5-fluorobenzenesulfonyl chloride. InChIKey: WGFLZPKSPVMZOA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClFNO2S
Molecular weight219.62 g/mol
IUPAC name2-cyano-5-fluorobenzenesulfonyl chloride
InChIKeyWGFLZPKSPVMZOA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)S(=O)(=O)Cl)C#N

Computed by PubChem (NCBI)