CAS 612541-15-8 appears in our catalog under these names: 2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 95%, 2-Cyano-5-fluorobenzenesulfonyl chloride, 98%, 2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 2-Cyano-5-fluorobenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.
2-cyano-5-fluorobenzenesulfonyl chloride (CAS 612541-15-8) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 2-cyano-5-fluorobenzenesulfonyl chloride. InChIKey: WGFLZPKSPVMZOA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 2-cyano-5-fluorobenzenesulfonyl chloride |
| InChIKey | WGFLZPKSPVMZOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)