CAS 351003-23-1 appears in our catalog under these names: 3-Cyano-4-fluorobenzenesulfonyl chloride, 97%, 3–Cyano–4–fluorobenzenesulfonyl chloride, 3-Cyano-4-fluorobenzenesulfonyl chloride 97%, 4-FLUORO-3-CYANOBENZENESULFONYL CHLORID&, 4-Fluoro-3-cyanobenzenesulfonyl chloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 250mg.
3-cyano-4-fluorobenzenesulfonyl chloride (CAS 351003-23-1) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 3-cyano-4-fluorobenzenesulfonyl chloride. InChIKey: KDVZADPGGPBAAK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-cyano-4-fluorobenzenesulfonyl chloride |
| InChIKey | KDVZADPGGPBAAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C#N)F |
Computed by PubChem (NCBI)