cas: 351003-23-1 — see every product listed under this CAS number, including other names
3–Cyano–4–fluorobenzenesulfonyl chloride (CAS 351003-23-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD07596-1g |
| cas | 351003-23-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 601.72 Pln | |
| GLPBio | 25g | 2567.53 Pln | |
| GLPBio | 5g | 980.84 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-cyano-4-fluorobenzenesulfonyl chloride (CAS 351003-23-1) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 3-cyano-4-fluorobenzenesulfonyl chloride. InChIKey: KDVZADPGGPBAAK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-cyano-4-fluorobenzenesulfonyl chloride |
| InChIKey | KDVZADPGGPBAAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C#N)F |
Computed by PubChem (NCBI)