cas: 351003-23-1 — see every product listed under this CAS number, including other names
4-Fluoro-3-cyanobenzenesulfonyl chloride, 95% (CAS 351003-23-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013064-1G |
| cas | 351003-23-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 25g | 1528.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-cyano-4-fluorobenzenesulfonyl chloride (CAS 351003-23-1) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 3-cyano-4-fluorobenzenesulfonyl chloride. InChIKey: KDVZADPGGPBAAK-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 3-cyano-4-fluorobenzenesulfonyl chloride |
| InChIKey | KDVZADPGGPBAAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)C#N)F |
Computed by PubChem (NCBI)