cas: 577-39-9 — see every product listed under this CAS number, including other names
3-FLUORO-4-METHOXY-5-NITROBENZOIC ACID, 97% (CAS 577-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472083-100MG |
| cas | 577-39-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 3689.34 Pln | |
| Fluorochem | 10g | 6162.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-4-methoxy-5-nitrobenzoic acid (CAS 577-39-9) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 3-fluoro-4-methoxy-5-nitrobenzoic acid. InChIKey: FZVATVOZGBMDRQ-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 3-fluoro-4-methoxy-5-nitrobenzoic acid |
| InChIKey | FZVATVOZGBMDRQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)