Products 1214385-61-1

CAS 1214385-61-1 is the registry number for 2-(3-Fluoro-4-nitrophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(3-fluoro-4-nitrophenyl)-2-hydroxyacetic acid (CAS 1214385-61-1) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 2-(3-fluoro-4-nitrophenyl)-2-hydroxyacetic acid. InChIKey: PZZLSSMQWRMHRN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6FNO5
Molecular weight215.13 g/mol
IUPAC name2-(3-fluoro-4-nitrophenyl)-2-hydroxyacetic acid
InChIKeyPZZLSSMQWRMHRN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(C(=O)O)O)F)[N+](=O)[O-]

Computed by PubChem (NCBI)