Products 1824284-36-7
CAS 1824284-36-7 appears in our catalog under these names: 4-Fluoro-2-methoxy-5-nitrobenzoic acid, 98%, 4-Fluoro-2-methoxy-5-nitrobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 10g.
4-fluoro-2-methoxy-5-nitrobenzoic acid (CAS 1824284-36-7) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 4-fluoro-2-methoxy-5-nitrobenzoic acid. InChIKey: VWJJZZCFGCQMOA-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 4-fluoro-2-methoxy-5-nitrobenzoic acid |
| InChIKey | VWJJZZCFGCQMOA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)