CAS 1592955-55-9 appears in our catalog under these names: 3-Fluoro-2-nitrophenoxyacetic acid, 96%, 2-(3-Fluoro-2-nitrophenoxy)acetic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 25g.
2-(3-fluoro-2-nitrophenoxy)acetic acid (CAS 1592955-55-9) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 2-(3-fluoro-2-nitrophenoxy)acetic acid. InChIKey: ICGSJWFPVDBNPW-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 2-(3-fluoro-2-nitrophenoxy)acetic acid |
| InChIKey | ICGSJWFPVDBNPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])OCC(=O)O |
Computed by PubChem (NCBI)