Products 864293-50-5
CAS 864293-50-5 appears in our catalog under these names: 4–Fluoro–5–methoxy–2–nitrobenzoic acid, 4-Fluoro-5-methoxy-2-nitrobenzoic acid, 97%, 4-Fluoro-5-methoxy-2-nitrobenzoic acid 95%, 4-Fluoro-5-methoxy-2-nitrobenzoic acid, 98%, 98%, 4-Fluoro-5-methoxy-2-nitrobenzoic acid, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 500mg, 2.5g, 25g.
4-fluoro-5-methoxy-2-nitrobenzoic acid (CAS 864293-50-5) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 4-fluoro-5-methoxy-2-nitrobenzoic acid. InChIKey: MGLFJUZFMICSSW-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 4-fluoro-5-methoxy-2-nitrobenzoic acid |
| InChIKey | MGLFJUZFMICSSW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)