3-Fluoro-2-(trifluoromethyl)benzamide
cas: 287398-80-5 — see every product listed under this CAS number, including other names
3-Fluoro-2-(trifluoromethyl)benzamide (CAS 287398-80-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005814-250MG |
| cas | 287398-80-5 |
| size | 250mg |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 565.44 Pln | |
| Fluorochem | 1g | 1060.06 Pln | |
| Fluorochem | 5g | 4006.94 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
3-fluoro-2-(trifluoromethyl)benzamide (CAS 287398-80-5) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)benzamide. InChIKey: JEHSVMLIHCECTD-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 3-fluoro-2-(trifluoromethyl)benzamide |
| InChIKey | JEHSVMLIHCECTD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)