cas: 938181-74-9 — see every product listed under this CAS number, including other names
3-Fluoro-2-[(phenylmethyl)oxy]benzoic acid (CAS 938181-74-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632710-1G |
| cas | 938181-74-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2918.78 Pln | |
| Fluorochem | 5g | 8619.90 Pln |
| delivery time | 3-4 weeks |
|---|
3-fluoro-2-phenylmethoxybenzoic acid (CAS 938181-74-9) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-fluoro-2-phenylmethoxybenzoic acid. InChIKey: YUNBJPVOGUIYJI-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-fluoro-2-phenylmethoxybenzoic acid |
| InChIKey | YUNBJPVOGUIYJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)