cas: 875166-92-0 — see every product listed under this CAS number, including other names
3-Fluoro-2-methylbenzenesulfonyl chloride (CAS 875166-92-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024625-250MG |
| cas | 875166-92-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 909.07 Pln | |
| Fluorochem | 10g | 1539.06 Pln |
| delivery time | 3-4 weeks |
|---|
3-fluoro-2-methylbenzenesulfonyl chloride (CAS 875166-92-0) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 3-fluoro-2-methylbenzenesulfonyl chloride. InChIKey: WKJLXHQGXSWSCK-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 3-fluoro-2-methylbenzenesulfonyl chloride |
| InChIKey | WKJLXHQGXSWSCK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)