cas: 719268-92-5 — see every product listed under this CAS number, including other names
3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 719268-92-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A140692-250mg |
| cas | 719268-92-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 25g | 2117.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A140692 |
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 719268-92-5) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VFMTUTYBMBTIGA-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VFMTUTYBMBTIGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)F |
Computed by PubChem (NCBI)