cas: 719268-92-5 — see every product listed under this CAS number, including other names
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%, 98% (CAS 719268-92-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1172G1-250mg |
| cas | 719268-92-5 |
| size | 250mg |
| availability | 225g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 25g | 1701.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 719268-92-5) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: VFMTUTYBMBTIGA-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | VFMTUTYBMBTIGA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)F |
Computed by PubChem (NCBI)