cas: 1352999-98-4 — see every product listed under this CAS number, including other names
3-Fluoro-5-(trifluoromethoxy)benzaldehyde 97% (CAS 1352999-98-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A805742-100mg |
| cas | 1352999-98-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 815.38 Pln | |
| Ambeed | 10g | 1549.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A805742 |
3-fluoro-5-(trifluoromethoxy)benzaldehyde (CAS 1352999-98-4) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 3-fluoro-5-(trifluoromethoxy)benzaldehyde. InChIKey: QIBNSINERFPXSF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 3-fluoro-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | QIBNSINERFPXSF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)F)C=O |
Computed by PubChem (NCBI)