cas: 1137869-93-2 — see every product listed under this CAS number, including other names
3-Fluoro-5-methoxy-4-nitrobenzoic acid, 95% (CAS 1137869-93-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 2.5g, 5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-2812-250mg |
| cas | 1137869-93-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 50mg | 737.26 Pln | |
| Fluorochem | 100mg | 919.49 Pln | |
| Fluorochem | 250mg | 1497.41 Pln | |
| Fluorochem | 1g | 3402.99 Pln | |
| Fluorochem | 2.5g | 6375.90 Pln | |
| Fluorochem | 5g | 12431.06 Pln | |
| Fluorochem | 10g | 23567.76 Pln | |
| Fluorochem | 25g | 54296.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-fluoro-5-methoxy-4-nitrobenzoic acid (CAS 1137869-93-2) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 3-fluoro-5-methoxy-4-nitrobenzoic acid. InChIKey: PXQRXFVLYSGNEL-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 3-fluoro-5-methoxy-4-nitrobenzoic acid |
| InChIKey | PXQRXFVLYSGNEL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)