cas: 1416367-00-4 — see every product listed under this CAS number, including other names
3-Fluoro-5-methoxyphenylboronic acid pinacol ester, 98%, 98% (CAS 1416367-00-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HW5Q-250mg |
| cas | 1416367-00-4 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 10g | 1000.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1416367-00-4) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: 2-(3-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DGHRKRRFVKPHDQ-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 2-(3-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DGHRKRRFVKPHDQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)OC |
Computed by PubChem (NCBI)