cas: 2369-12-2 — see every product listed under this CAS number, including other names
3-Fluoro-5-nitroaniline, 98% (CAS 2369-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076392-250MG |
| cas | 2369-12-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1486.99 Pln | |
| Fluorochem | 10g | 2403.34 Pln | |
| Fluorochem | 25g | 4725.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-fluoro-5-nitroaniline (CAS 2369-12-2) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-5-nitroaniline. InChIKey: OPMFAZASMJCCOQ-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-5-nitroaniline |
| InChIKey | OPMFAZASMJCCOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)