Benzenamine, 3-fluoro-5-nitro-, 98%, 98%
cas: 2369-12-2 — see every product listed under this CAS number, including other names
Benzenamine, 3-fluoro-5-nitro-, 98%, 98% (CAS 2369-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113O70-250mg |
| cas | 2369-12-2 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 914.00 Pln | |
| Chemat | 10g | 1466.00 Pln | |
| Chemat | 25g | 2867.60 Pln | |
| Chemat | 100g | 9045.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluoro-5-nitroaniline (CAS 2369-12-2) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-5-nitroaniline. InChIKey: OPMFAZASMJCCOQ-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-5-nitroaniline |
| InChIKey | OPMFAZASMJCCOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)