cas: 584-87-2 — see every product listed under this CAS number, including other names
3-Formyl-4-hydroxybenzoic acid 95% (CAS 584-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199930-250mg |
| cas | 584-87-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 25g | 1165.81 Pln | |
| Ambeed | 100g | 4442.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199930 |
3-formyl-4-hydroxybenzoic acid (CAS 584-87-2) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 3-formyl-4-hydroxybenzoic acid. InChIKey: NXZBZWZORYEIJL-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 3-formyl-4-hydroxybenzoic acid |
| InChIKey | NXZBZWZORYEIJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C=O)O |
Computed by PubChem (NCBI)