cas: 584-87-2 — see every product listed under this CAS number, including other names
3-Formyl-4-hydroxybenzoic acid, 95%, 95% (CAS 584-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JHY-100mg |
| cas | 584-87-2 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 611.60 Pln | |
| Chemat | 50g | 1130.00 Pln | |
| Chemat | 100g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-formyl-4-hydroxybenzoic acid (CAS 584-87-2) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 3-formyl-4-hydroxybenzoic acid. InChIKey: NXZBZWZORYEIJL-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 3-formyl-4-hydroxybenzoic acid |
| InChIKey | NXZBZWZORYEIJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C=O)O |
Computed by PubChem (NCBI)