3-Furancarbothioicacid, S-(2,5-dimethyl-3-furanyl) ester, 92%, 92%
cas: 65505-16-0 — see every product listed under this CAS number, including other names
3-Furancarbothioicacid, S-(2,5-dimethyl-3-furanyl) ester, 92%, 92% (CAS 65505-16-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140VI-250mg |
| cas | 65505-16-0 |
| size | 250mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1883.60 Pln |
properties
| purity | 92% |
|---|---|
| delivery time | 3 weeks |
S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate (CAS 65505-16-0) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate. InChIKey: QVKDTUVQQAKGEO-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate |
| InChIKey | QVKDTUVQQAKGEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)SC(=O)C2=COC=C2 |
Computed by PubChem (NCBI)
Synonyms:
S-(2,5-dimethylfuran-3-yl) furan-3-carbothioate, 3-Furancarbothioicacid, S-(2,5-dimethyl-3-furanyl) ester, FEMA No. 3481, S-(2,5-Dimethyl-3-furyl) thio-3-furoate, 3-Furancarbothioic acid, S-(2,5-dimethyl-3-furanyl) ester, S-(2,5-dimethyl-3-furyl) furan-3-carbothioate, QVKDTUVQQAKGEO-UHFFFAOYSA-N