cas: 87565-98-8 — see every product listed under this CAS number, including other names
3-Hydrazinobenzoic Acid Hydrochloride, 98%, 98% (CAS 87565-98-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JJ1-1g |
| cas | 87565-98-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 530.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-hydrazinylbenzoic acid;hydrochloride (CAS 87565-98-8) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 3-hydrazinylbenzoic acid;hydrochloride. InChIKey: YONFQPJFIKYVLO-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 3-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | YONFQPJFIKYVLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NN)C(=O)O.Cl |
Computed by PubChem (NCBI)