cas: 87565-98-8 — see every product listed under this CAS number, including other names
3-Hydrazinobenzoic acid hydrochloride, 95% (CAS 87565-98-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F061135-1G |
| cas | 87565-98-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 294.71 Pln | |
| Fluorochem | 50g | 534.20 Pln | |
| Fluorochem | 100g | 758.08 Pln | |
| Fluorochem | 500g | 3236.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-hydrazinylbenzoic acid;hydrochloride (CAS 87565-98-8) is a chemical compound with the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. IUPAC name: 3-hydrazinylbenzoic acid;hydrochloride. InChIKey: YONFQPJFIKYVLO-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O2 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 3-hydrazinylbenzoic acid;hydrochloride |
| InChIKey | YONFQPJFIKYVLO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NN)C(=O)O.Cl |
Computed by PubChem (NCBI)