cas: 6635-42-3 — see every product listed under this CAS number, including other names
3-Hydrazinylbenzo[d]isothiazole 1,1-dioxide, 95%, 95% (CAS 6635-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117N0I-100mg |
| cas | 6635-42-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 500mg | 645.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1,1-dioxo-1,2-benzothiazol-3-yl)hydrazine (CAS 6635-42-3) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: (1,1-dioxo-1,2-benzothiazol-3-yl)hydrazine. InChIKey: UIIBWSCDDIBUHB-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | (1,1-dioxo-1,2-benzothiazol-3-yl)hydrazine |
| InChIKey | UIIBWSCDDIBUHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)NN |
Computed by PubChem (NCBI)