cas: 6068-76-4 — see every product listed under this CAS number, including other names
3-Hydroxy-2-(2-hydroxyphenyl)-4H-chromen-4-one, 98%, 98% (CAS 6068-76-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IBG-100mg |
| cas | 6068-76-4 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 851.60 Pln | |
| Chemat | 10g | 1562.00 Pln | |
| Chemat | 25g | 3059.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one (CAS 6068-76-4) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one. InChIKey: VECGDSZOFMYGAF-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-hydroxy-2-(2-hydroxyphenyl)chromen-4-one |
| InChIKey | VECGDSZOFMYGAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=O)C3=CC=CC=C3O2)O)O |
Computed by PubChem (NCBI)