cas: 3665-51-8 — see every product listed under this CAS number, including other names
3-Hydroxy-2-naphthalenecarboxamide (CAS 3665-51-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I80G-1g |
| cas | 3665-51-8 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1134.80 Pln |
| delivery time | 3 weeks |
|---|
3-hydroxynaphthalene-2-carboxamide (CAS 3665-51-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 3-hydroxynaphthalene-2-carboxamide. InChIKey: NFTNTGFZYSCPSK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 3-hydroxynaphthalene-2-carboxamide |
| InChIKey | NFTNTGFZYSCPSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)N)O |
Computed by PubChem (NCBI)