CAS 3665-51-8 appears in our catalog under these names: 2-Hydroxy-3-naphtoamide, 95%, 3-Hydroxy-2-naphthalenecarboxamide. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g.
3-hydroxynaphthalene-2-carboxamide (CAS 3665-51-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 3-hydroxynaphthalene-2-carboxamide. InChIKey: NFTNTGFZYSCPSK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 3-hydroxynaphthalene-2-carboxamide |
| InChIKey | NFTNTGFZYSCPSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)N)O |
Computed by PubChem (NCBI)