cas: 602-00-6 — see every product listed under this CAS number, including other names
3-Hydroxy-2-nitrobenzoic Acid, >98.0%(GC)(T) (CAS 602-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H1324-1G |
| cas | 602-00-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 177.35 Pln | |
| TCI | 5g | 629.74 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
3-hydroxy-2-nitrobenzoic acid (CAS 602-00-6) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-2-nitrobenzoic acid. InChIKey: KPDBKQKRDJPBRM-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-2-nitrobenzoic acid |
| InChIKey | KPDBKQKRDJPBRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)