CAS 619-19-2 appears in our catalog under these names: 2-Hydroxy-4-nitrobenzoic acid, 97%, 2-Hydroxy-4-nitrobenzoic acid 97%, 2-Hydroxy-4-nitrobenzoic acid, 97%, 97%, 4–Nitrosalicylic Acid, 4-Nitrosalicylic Acid, >98.0%(T). Offered by: Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Fluorochem, Chemat. Available pack sizes: 25g, 1g, 10g, 100g, 500g, 5g.
2-hydroxy-4-nitrobenzoic acid (CAS 619-19-2) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 2-hydroxy-4-nitrobenzoic acid. InChIKey: UKWUOTZGXIZAJC-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 2-hydroxy-4-nitrobenzoic acid |
| InChIKey | UKWUOTZGXIZAJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])O)C(=O)O |
Computed by PubChem (NCBI)