Products 78238-14-9
CAS 78238-14-9 appears in our catalog under these names: 3-Hydroxy-5-nitrobenzoic acid, 3–Hydroxy–5–nitrobenzoic acid, 3-Hydroxy-5-nitrobenzoic acid 97%, 3-HYDROXY-5-NITROBENZOIC ACID, 97%, 3-HYDROXY-5-NITROBENZOIC ACID, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 25g, 5g, 10g, 50g, 100g, 1g, 250mg.
3-hydroxy-5-nitrobenzoic acid (CAS 78238-14-9) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-5-nitrobenzoic acid. InChIKey: ZVLLYIMPDTXFNC-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-5-nitrobenzoic acid |
| InChIKey | ZVLLYIMPDTXFNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O)C(=O)O |
Computed by PubChem (NCBI)