CAS 602-00-6 appears in our catalog under these names: 3-Hydroxy-2-nitrobenzoic Acid, 3–Hydroxy–2–nitrobenzoic Acid, 3-Hydroxy-2-nitrobenzoic acid, 98+% , 3-Hydroxy-2-nitrobenzoic Acid, >98.0%(GC)(T), 3-Hydroxy-2-nitrobenzoic acid 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 500mg, 5g, 2g, 10g, 25g, 50g, 100g.
3-hydroxy-2-nitrobenzoic acid (CAS 602-00-6) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-2-nitrobenzoic acid. InChIKey: KPDBKQKRDJPBRM-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-2-nitrobenzoic acid |
| InChIKey | KPDBKQKRDJPBRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)