Products 6281-23-8
CAS 6281-23-8 appears in our catalog under these names: 3-(5-Nitro-2-furyl)acrylic acid, 95%, 3-(5-Nitro-2-furyl)acrylic Acid, >97.0%(HPLC), 3-(5-Nitrofuran-2-yl)acrylic acid, 97.0%, 97.0%. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 1g, 25g, 5g.
(E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid (CAS 6281-23-8) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: (E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid. InChIKey: LWOWNIPZHGWKNR-DUXPYHPUSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | (E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid |
| InChIKey | LWOWNIPZHGWKNR-DUXPYHPUSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(5-Nitro-2-furyl)acrylic acid, 5-Nitro-2-furanacrylic acid, Nitrofurylacrylic acid, 2-Propenoic acid, 3-(5-nitro-2-furanyl)-, 5-nitro-2-furylacrylic acid, 3-(5-Nitro-2-furanyl)-2-propenoic acid, 3-(5-Nitrofuran-2-yl)acrylic acid, (2E)-3-(5-nitrofuran-2-yl)prop-2-enoic acid, 5-Nitrofurylacrylic acid, trans-5-nitro-2-furanacrylic acid