cas: 78238-14-9 — see every product listed under this CAS number, including other names
3-Hydroxy-5-nitrobenzoic acid, 98% (CAS 78238-14-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225465-5G |
| cas | 78238-14-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 253.05 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 815.36 Pln | |
| Fluorochem | 100g | 2892.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-hydroxy-5-nitrobenzoic acid (CAS 78238-14-9) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 3-hydroxy-5-nitrobenzoic acid. InChIKey: ZVLLYIMPDTXFNC-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 3-hydroxy-5-nitrobenzoic acid |
| InChIKey | ZVLLYIMPDTXFNC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O)C(=O)O |
Computed by PubChem (NCBI)